| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | isopropyl 4-chloro-o-tolyloxyacetate |
| CAS: | 1-methylethyl (4-chloro-2-methylphenoxy)acetate |
| Reg. No.: | 2698-40-0 |
| Formula: | C12H15ClO3 |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | This substance is a derivative of MCPA [94-74-6]. The name “metaxon-isopropyl” was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | ěm sē pē ā ī-sō-prō-pīl Guide to British pronunciation |
| InChI: | InChI=1/C12H15ClO3/c1-8(2)16-12(14)7-15-11-5-4-10(13)6-9(11)3/h4-6,8H,7H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names