| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | isobutyl 4-chloro-o-tolyloxyacetate |
| CAS: | 2-methylpropyl (4-chloro-2-methylphenoxy)acetate |
| Reg. No.: | 1713-11-7 |
| Formula: | C13H17ClO3 |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | This substance is a derivative of MCPA [94-74-6]. The name “metaxon-isobutyl” was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | ěm sē pē ā ī-sō-bū-tīl Guide to British pronunciation |
| InChI: | InChI=1/C13H17ClO3/c1-9(2)7-17-13(15)8-16-12-5-4-11(14)6-10(12)3/h4-6,9H,7-8H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names