Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | (4-chloro-2-methylphenoxy)acetic acid—2,2′-azanediyldi(ethan-1-ol) (1/1) |
IUPAC name: | [(4-chloro-o-tolyl)oxy]acetic acid - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium [(4-chloro-o-tolyl)oxy]acetate/td> |
CAS name: | 2-(4-chloro-2-methylphenoxy)acetic acid compound with 2,2′-iminobis[ethanol] (1:1) |
CAS Reg. No.: | 20405-19-0 |
Formula: | C13H20ClNO5 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of MCPA [94-74-6]. |
Structure: | |
Pronunciation: | ěm sē pē ā dī-ǒl-a-mēn Guide to British pronunciation |
InChIKey: | XQAVWNJMMDWIKG-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H9ClO3.C4H11NO2/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;6-3-1-5-2-4-7/h2-4H,5H2,1H3,(H,11,12);5-7H,1-4H2 |
A data sheet from the Compendium of Pesticide Common Names