| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 4-chloro-o-tolyloxyacetic acid - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium 4-chloro-o-tolyloxyacetate |
| CAS: | (4-chloro-2-methylphenoxy)acetic acid compound with 2,2′-iminobis[ethanol] (1:1) |
| Reg. No.: | 20405-19-0 |
| Formula: | C13H20ClNO5 |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | This substance is a derivative of MCPA [94-74-6]. The name “metaxon-diolamine” was used in the former USSR. |
| Structure: | ![]() |
| InChI: | InChI=1/C9H9ClO3.C4H11NO2/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;6-3-1-5-2-4-7/h2-4H,5H2,1H3,(H,11,12);5-7H,1-4H2/f/h11H; |
A data sheet from the Compendium of Pesticide Common Names