| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 4-chloro-o-tolyloxyacetic acid - dimethylamine (1:1) or dimethylammonium 4-chloro-o-tolyloxyacetate |
| CAS: | (4-chloro-2-methylphenoxy)acetic acid compound with N-methylmethanamine (1:1) |
| Reg. No.: | 2039-46-5 |
| Formula: | C11H16ClNO3 |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | This substance is a derivative of MCPA [94-74-6]. The name “metaxon-dimethylammonium” was used in the former USSR. |
| Structure: | ![]() |
| InChI: | InChI=1/C9H9ClO3.C2H7N/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;1-3-2/h2-4H,5H2,1H3,(H,11,12);3H,1-2H3/f/h11H; |
A data sheet from the Compendium of Pesticide Common Names