| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 2-ethylhexyl 4-chloro-o-tolyloxyacetate |
| CAS: | 2-ethylhexyl (4-chloro-2-methylphenoxy)acetate |
| Reg. No.: | 29450-45-1 |
| Formula: | C17H25ClO3 |
| Activity: | herbicides (phenoxyacetic herbicides) |
| Notes: | This substance is a derivative of MCPA [94-74-6]. The name “metaxon-2-ethylhexyl” was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | ěm sē pē ā too ē-thīl-hěks-īl Guide to British pronunciation |
| InChI: | InChI=1/C17H25ClO3/c1-4-6-7-14(5-2)11-21-17(19)12-20-16-9-8-15(18)10-13(16)3/h8-10,14H,4-7,11-12H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names