| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | reaction mixture of methyl 6-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-m-toluate and methyl 2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]-p-toluate |
| CAS: | methyl 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-4(or 5)-methylbenzoate |
| Reg. No.: | 81405-85-8 |
| Formula: | C16H20N2O3 |
| Activity: | herbicides (imidazolinone herbicides) |
| Notes: | This substance is a derivative of imazamethabenz [100728-84-5]. |
| Structure: | ![]() |
| InChI: | 4-methyl isomer InChI=1/C16H20N2O3/c1-9(2)16(4)15(20)17-13(18-16)12-8-10(3)6-7-11(12)14(19)21-5/h6-9H,1-5H3,(H,17,18,20)/t16-/s3/f/h17H 5-methyl isomer InChI=1/C16H20N2O3/c1-9(2)16(4)15(20)17-13(18-16)11-7-6-10(3)8-12(11)14(19)21-5/h6-9H,1-5H3,(H,17,18,20)/t16-/s3/f/h17H |
A data sheet from the Compendium of Pesticide Common Names