| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-1-(β-allyloxy-2,4-dichlorophenylethyl)imidazole nitrate or allyl (RS)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl ether nitrate |
| CAS: | 1-[2-(2,4-dichlorophenyl)-2-(2-propenyloxy)ethyl]-1H-imidazole mononitrate |
| Reg. No.: | 33586-66-2 |
| Formula: | C14H15Cl2N3O4 |
| Activity: | fungicides (conazole fungicides) |
| Notes: | This substance is a derivative of imazalil [35554-44-0]. The name “enilconazole nitrate” is approved by the World Health Organization. |
| Structure: | ![]() |
| InChI: | InChI=1/C14H14Cl2N2O.HNO3/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16;2-1(3)4/h2-6,8,10,14H,1,7,9H2;(H,2,3,4)/t14-;/s3/f/h;2H |
A data sheet from the Compendium of Pesticide Common Names