Status: | modified ISO 1750 (provisionally approved) |
---|---|
IUPAC PIN: | methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylate |
IUPAC name: | methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylate or methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)picolinate |
CAS name: | methyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-2-pyridinecarboxylate |
CAS Reg. No.: | 943831-98-9 |
Formula: | C14H11Cl2FN2O3 |
Activity: | herbicides (pyridinecarboxylic acid) |
Notes: | This substance is a derivative of halauxifen [943832-60-8]. |
Structure: | |
Pronunciation: | hǎl-orks-ǐ-fěn mē-thīl Guide to British pronunciation |
InChIKey: | KDHKOPYYWOHESS-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H11Cl2FN2O3/c1-21-13-7(15)4-3-6(11(13)17)9-5-8(18)10(16)12(19-9)14(20)22-2/h3-5H,1-2H3,(H2,18,19) |
A data sheet from the Compendium of Pesticide Common Names