| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | butyl (RS)-2-(2,4,5-trichlorophenoxy)propionate |
| CAS: | butyl 2-(2,4,5-trichlorophenoxy)propanoate |
| Reg. No.: | 13557-98-7 |
| Formula: | C13H15Cl3O3 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of fenoprop [93-72-1]. The name “silvex-butyl” is used in the USA. The name “2,4,5-TP-butyl” is used in France and was used in the former USSR. |
| Structure: |  |
| Pronunciation: | fěn-ō-prǒp bū-tīl Guide to British pronunciation |
| InChI: | InChI=1/C13H15Cl3O3/c1-3-4-5-18-13(17)8(2)19-12-7-10(15)9(14)6-11(12)16/h6-8H,3-5H2,1-2H3/t8-/s3 |