| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-butoxy-1-methylethyl (RS)-2-(2,4,5-trichlorophenoxy)propionate |
| CAS: | 2-butoxy-1-methylethyl 2-(2,4,5-trichlorophenoxy)propanoate |
| Reg. No.: | |
| Formula: | C16H21Cl3O4 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of fenoprop [93-72-1]. The name “silvex-butometyl” is used in the USA. The name “2,4,5-TP-butometyl” is used in France and was used in the former USSR. |
| Structure: |  |
| Pronunciation: | fěn-ō-prǒp bū-tō-mē-tīl Guide to British pronunciation |
| InChI: | InChI=1/C16H21Cl3O4/c1-4-5-6-21-9-10(2)22-16(20)11(3)23-15-8-13(18)12(17)7-14(15)19/h7-8,10-11H,4-6,9H2,1-3H3/t10-,11+/s3 |