Status: | modified ISO 765 |
---|---|
IUPAC PIN: | ethyl (naphthalen-1-yl)acetate |
IUPAC name: | ethyl 1-naphthylacetate |
CAS name: | ethyl 1-naphthaleneacetate |
CAS Reg. No.: | 2122-70-5 |
Formula: | C14H14O2 |
Activity: | plant growth regulators (auxin) |
Notes: | This substance is a derivative of 1-naphthaleneacetic acid [86-87-3]. |
Structure: | |
Pronunciation: | ē-thīl wǔn nǎf-tha-lēn-ǎs-ǐ-tāt Guide to British pronunciation |
InChIKey: | XIDPSKQLXKCVQN-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H14O2/c1-2-16-14(15)10-12-8-5-7-11-6-3-4-9-13(11)12/h3-9H,2,10H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names