| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | dipotassium 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| CAS: | dipotassium 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| Reg. No.: | 2164-07-0 |
| Formula: | C8H8K2O5 |
| Activity: | algicides herbicides (unclassified herbicides) plant growth regulators (defoliants) |
| Notes: | This substance is a derivative of endothal [145-73-3]. The name “endothall-dipotassium” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | ěn-dō-thǎl dī-pa-tǎs-ē-am Guide to British pronunciation |
| InChI: | InChI=1/C8H10O5.2K/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;;/h3-6H,1-2H2,(H,9,10)(H,11,12);;/q;2*+1/p-2/fC8H8O5.2K/q-2;2m |