| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | diammonium 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| CAS: | diammonium 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| Reg. No.: | 17439-94-0 |
| Formula: | C8H16N2O5 |
| Activity: | algicides herbicides (unclassified herbicides) plant growth regulators (defoliants) |
| Notes: | This substance is a derivative of endothal [145-73-3]. The name “endothall-diammonium” is approved by the Weed Science Society of America. |
| Structure: | ![]() |
| InChI: | InChI=1/C8H10O5.2H3N/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;;/h3-6H,1-2H2,(H,9,10)(H,11,12);2*1H3/fC8H8O5.2H4N/h;2*1H/q-2;2*+1 |
A data sheet from the Compendium of Pesticide Common Names