| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium N-[2-(2-dodecylaminoethylamino)ethyl]glycinate or sodium 3,6,9-triazaheneicosanoate |
| CAS: | N-[2-[[2-(dodecylamino)ethyl]amino]ethyl]glycine sodium salt (1:1) |
| Reg. No.: | 59079-49-1 |
| Formula: | C18H38N3NaO2 |
| Activity: | bactericides fungicides (aliphatic nitrogen fungicides) |
| Notes: | This substance is a derivative of dodicin [6843-97-6]. |
| Structure: | ![]() |
| Pronunciation: | dō-dǐ-sǐn sō-dē-am Guide to British pronunciation |
| InChIKey: | XKKTVIWAHIWFAN-UHFFFAOYSA-M |
| InChI: | InChI=1S/C18H39N3O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-19-13-14-20-15-16-21-17-18(22)23;/h19-21H,2-17H2,1H3,(H,22,23);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names