| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 4-cyclododecyl-2,6-dimethylmorpholine benzoate |
| CAS: | 4-cyclododecyl-2,6-dimethylmorpholine benzoate (1:1) |
| Reg. No.: | 59145-63-0 |
| Formula: | C25H41NO3 |
| Activity: | fungicides (morpholine fungicides) |
| Notes: | This substance is a derivative of dodemorph [1593-77-7]. The names “dodemorph” and “dodemorph benzoate” were both formerly approved by ISO, but “dodemorph benzoate” was deleted in 1989 as part of a rationalisation exercise. |
| Structure: |  |
| Pronunciation: | dō-dē-morf běn-zō-āt Guide to British pronunciation |
| InChI: | InChI=1/C18H35NO.C7H6O2/c1-16-14-19(15-17(2)20-16)18-12-10-8-6-4-3-5-7-9-11-13-18;8-7(9)6-4-2-1-3-5-6/h16-18H,3-15H2,1-2H3;1-5H,(H,8,9)/f/h;8H |