| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium 4,6-dinitro-o-cresolate |
| CAS: | sodium 2-methyl-4,6-dinitrophenolate |
| Reg. No.: | 2312-76-7 |
| Formula: | C7H5N2NaO5 |
| Activity: | acaricides (dinitrophenol acaricides) fungicides (dinitrophenol fungicides) herbicides (dinitrophenol herbicides) insecticides (dinitrophenol insecticides) |
| Notes: | This substance is a derivative of DNOC [534-52-1]. |
| Structure: | ![]() |
| Pronunciation: | dē ěn ō sē sō-dē-am Guide to British pronunciation |
| InChIKey: | JQYJSVBNPUHHKB-UHFFFAOYSA-M |
| InChI: | InChI=1S/C7H6N2O5.Na/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14;/h2-3,10H,1H3;/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names