Status: | modified ISO 1750 (published) |
---|---|
IUPAC name: | ammonium 4,6-dinitro-o-cresolate |
CAS name: | ammonium 2-methyl-4,6-dinitrophenolate |
CAS Reg. No.: | 2980-64-5 |
Formula: | C7H9N3O5 |
Activity: | acaricides (dinitrophenol) fungicides (dinitrophenol) herbicides (dinitrophenol) insecticides (dinitrophenol) |
Notes: | This substance is a derivative of DNOC [534-52-1]. |
Structure: | |
Pronunciation: | dē ěn ō sē a-mōn-ē-am Guide to British pronunciation |
InChIKey: | QOHVLZBCVSJGFV-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H6N2O5.H3N/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14;/h2-3,10H,1H3;1H3 |
A data sheet from the Compendium of Pesticide Common Names