Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenyl acetate |
IUPAC name: | (RS)-2-sec-butyl-4,6-dinitrophenyl acetate |
CAS name: | 2-(1-methylpropyl)-4,6-dinitrophenyl acetate |
CAS Reg. No.: | 2813-95-8 |
Formula: | C12H14N2O6 |
Activity: | herbicides (dinitrophenol) |
Notes: | This substance is a derivative of dinoseb [88-85-7]. |
Structure: | |
Pronunciation: | dī-nō-sěb ǎs-ǐ-tāt Guide to British pronunciation |
InChIKey: | RDJTWDKSYLLHRW-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H14N2O6/c1-4-7(2)10-5-9(13(16)17)6-11(14(18)19)12(10)20-8(3)15/h5-7H,4H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names