Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-methyl (2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate |
IUPAC name: | methyl (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionate |
CAS name: | methyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate |
CAS Reg. No.: | 51338-27-3 |
Formula: | C16H14Cl2O4 |
Activity: | herbicides (aryloxyphenoxypropionic) |
Notes: | This substance is a derivative of diclofop [40843-25-2]. |
Structure: | |
Pronunciation: | dī-clō-fǒp mē-thīl Guide to British pronunciation |
InChIKey: | BACHBFVBHLGWSL-UHFFFAOYSA-N |
InChI: | InChI=1S/C16H14Cl2O4/c1-10(16(19)20-2)21-12-4-6-13(7-5-12)22-15-8-3-11(17)9-14(15)18/h3-10H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names