| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | potassium (RS)-2-(2,4-dichlorophenoxy)propionate |
| CAS: | potassium 2-(2,4-dichlorophenoxy)propanoate |
| Reg. No.: | 5746-17-8 |
| Formula: | C9H7Cl2KO3 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of dichlorprop [120-36-5]. The name “2,4-DP-potassium” was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | dī-klor-prǒp pa-tǎs-ē-am Guide to British pronunciation |
| InChI: | InChI=1/C9H8Cl2O3.K/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;/h2-5H,1H3,(H,12,13);/q;+1/p-1/t5-;/s3/fC9H7Cl2O3.K/q-1;m |
A data sheet from the Compendium of Pesticide Common Names