| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (2RS)-2-ethylhexyl (2R)-2-(2,4-dichlorophenoxy)propionate |
| CAS: | 2-ethylhexyl (2R)-2-(2,4-dichlorophenoxy)propanoate |
| Reg. No.: | 865363-39-9 |
| Formula: | C17H24Cl2O3 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of dichlorprop-P [15165-67-0]. The unresolved isomeric mixture of this substance has the ISO common name dichlorprop-2-ethylhexyl [79270-78-3]. |
| Structure: |  |
| Pronunciation: | dī-klor-prǒp pē too ē-thīl-hěks-īl Guide to British pronunciation |
| InChIKey: | CEEDFYRUPAWDOU-PZORYLMUSA-N |
| InChI: | InChI=1S/C17H24Cl2O3/c1-4-6-7-13(5-2)11-21-17(20)12(3)22-16-9-8-14(18)10-15(16)19/h8-10,12-13H,4-7,11H2,1-3H3/t12-,13?/m1/s1 |