Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-methyl (2R)-2-(2,4-dichlorophenoxy)propanoate |
IUPAC name: | methyl (2RS)-2-(2,4-dichlorophenoxy)propionate |
CAS name: | methyl 2-(2,4-dichlorophenoxy)propanoate |
CAS Reg. No.: | 57153-17-0 |
Formula: | C10H10Cl2O3 |
Activity: | herbicides (phenoxypropionic) plant growth regulators (auxin) |
Notes: | This substance is a derivative of dichlorprop [120-36-5]. |
Structure: | |
Pronunciation: | dī-klor-prǒp mē-thīl Guide to British pronunciation |
InChIKey: | SCHCPDWDIOTCMJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H10Cl2O3/c1-6(10(13)14-2)15-9-4-3-7(11)5-8(9)12/h3-6H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names