| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | methyl (RS)-2-(2,4-dichlorophenoxy)propionate |
| CAS: | methyl 2-(2,4-dichlorophenoxy)propanoate |
| Reg. No.: | 57153-17-0 |
| Formula: | C10H10Cl2O3 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of dichlorprop [120-36-5]. The name “2,4-DP-methyl” was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | dī-klor-prǒp mē-thīl Guide to British pronunciation |
| InChI: | InChI=1/C10H10Cl2O3/c1-6(10(13)14-2)15-9-4-3-7(11)5-8(9)12/h3-6H,1-2H3/t6-/s3 |
A data sheet from the Compendium of Pesticide Common Names