Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-(2R)-2-(2,4-dichlorophenoxy)propanoic acid—ethanamine (1/1) |
IUPAC name: | (2RS)-2-(2,4-dichlorophenoxy)propionic acid - ethylamine (1:1) or ethylammonium (2RS)-2-(2,4-dichlorophenoxy)propionate |
CAS name: | 2-(2,4-dichlorophenoxy)propanoic acid compound with ethanamine (1:1) |
CAS Reg. No.: | |
Formula: | C11H15Cl2NO3 |
Activity: | herbicides (phenoxypropionic) plant growth regulators (auxin) |
Notes: | This substance is a derivative of dichlorprop [120-36-5]. |
Structure: | |
Pronunciation: | dī-klor-prǒp ē-thīl-a-mōn-ē-am Guide to British pronunciation |
InChIKey: | XKRTULOWSCJFER-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H8Cl2O3.C2H7N/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;1-2-3/h2-5H,1H3,(H,12,13);2-3H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names