| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-(2,4-dichlorophenoxy)propanoic acid - dimethylamine (1:1) or dimethylammonium (RS)-2-(2,4-dichlorophenoxy)propionate |
| CAS: | 2-(2,4-dichlorophenoxy)propanoic acid compound with N-methylmethanamine (1:1) |
| Reg. No.: | 53404-32-3 |
| Formula: | C11H15Cl2NO3 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of dichlorprop [120-36-5]. The name “2,4-DP-dimethylammonium” was used in the former USSR. The (R)-isomer of this substance has the ISO common name dichlorprop-P-dimethylammonium. |
| Structure: |  |
| InChI: | InChI=1/C9H8Cl2O3.C2H7N/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;1-3-2/h2-5H,1H3,(H,12,13);3H,1-2H3/t5-;/s3/f/h12H; |