| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 2-butoxyethyl (RS)-2-(2,4-dichlorophenoxy)propionate |
| CAS: | 2-butoxyethyl 2-(2,4-dichlorophenoxy)propanoate |
| Reg. No.: | 53404-31-2 |
| Formula: | C15H20Cl2O4 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of dichlorprop [120-36-5]. The name “2,4-DP-butotyl” was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | dī-klor-prǒp bū-tō-tīl Guide to British pronunciation |
| InChI: | InChI=1/C15H20Cl2O4/c1-3-4-7-19-8-9-20-15(18)11(2)21-14-6-5-12(16)10-13(14)17/h5-6,10-11H,3-4,7-9H2,1-2H3/t11-/s3 |
A data sheet from the Compendium of Pesticide Common Names