| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-ethylhexyl (RS)-2-(2,4-dichlorophenoxy)propionate |
| CAS: | 2-ethylhexyl 2-(2,4-dichlorophenoxy)propanoate |
| Reg. No.: | 79270-78-3 |
| Formula: | C17H24Cl2O3 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of dichlorprop [120-36-5]. The name “2,4-DP-2-ethylhexyl” was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | dī-klor-prǒp too ē-thīl-hěks-īl Guide to British pronunciation |
| InChI: | InChI=1/C17H24Cl2O3/c1-4-6-7-13(5-2)11-21-17(20)12(3)22-16-9-8-14(18)10-15(16)19/h8-10,12-13H,4-7,11H2,1-3H3/t12-,13-/s3 |
A data sheet from the Compendium of Pesticide Common Names