| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (2RS)-2-ethylhexyl (2RS)-2-(2,4-dichlorophenoxy)propionate |
| CAS: | 2-ethylhexyl 2-(2,4-dichlorophenoxy)propanoate |
| Reg. No.: | 79270-78-3 |
| Formula: | C17H24Cl2O3 |
| Activity: | herbicides (phenoxypropionic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of dichlorprop [120-36-5]. The (2R)-isomer of this substance has the ISO common name dichlorprop-P-2-ethylhexyl [865363-39-9]. |
| Structure: | ![]() |
| Pronunciation: | dī-klor-prǒp too ē-thīl-hěks-īl Guide to British pronunciation |
| InChIKey: | CEEDFYRUPAWDOU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C17H24Cl2O3/c1-4-6-7-13(5-2)11-21-17(20)12(3)22-16-9-8-14(18)10-15(16)19/h8-10,12-13H,4-7,11H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names