| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | methyl 2,7-dichloro-9-hydroxyfluorene-9-carboxylate |
| CAS: | methyl 2,7-dichloro-9-hydroxy-9H-fluorene-9-carboxylate |
| Reg. No.: | 21634-96-8 |
| Formula: | C15H10Cl2O3 |
| Activity: | plant growth regulators (morphactins) |
| Notes: | This substance is a derivative of dichlorflurenol [69622-79-3]. The name “dichlorflurecol-methyl” is used in Canada. |
| Structure: | ![]() |
| Pronunciation: | dī-klor-flūr-ē-nǒl mē-thīl Guide to British pronunciation |
| InChI: | InChI=1/C15H10Cl2O3/c1-20-14(18)15(19)12-6-8(16)2-4-10(12)11-5-3-9(17)7-13(11)15/h2-7,19H,1H3 |
A data sheet from the Compendium of Pesticide Common Names