Status: | modified ISO 1750 (published) |
---|---|
PIN: | 3,6-dichloro-2-methoxybenzoic acid—2,2′,2″-nitrilotri(ethan-1-ol) (1/1) |
IUPAC: | 3,6-dichloro-o-anisic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium 3,6-dichloro-o-anisate or 3,6-dichloro-2-methoxybenzoic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium 3,6-dichloro-2-methoxybenzoate |
CAS: | 3,6-dichloro-2-methoxybenzoic acid compound with 2,2′,2″-nitrilotris[ethanol] (1:1) |
CAS Reg. No.: | 53404-29-8 |
Formula: | C14H21Cl2NO6 |
Activity: | herbicides (benzoic acid herbicides) plant growth regulators (unclassified plant growth regulators) |
Notes: | This substance is a derivative of dicamba [1918-00-9]. |
Structure: | |
Pronunciation: | dī-kǎm-ba trǒl-a-mēn Guide to British pronunciation |
InChIKey: | ZMLZTMPXQOOCNI-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H6Cl2O3.C6H15NO3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;8-4-1-7(2-5-9)3-6-10/h2-3H,1H3,(H,11,12);8-10H,1-6H2 |
A data sheet from the Compendium of Pesticide Common Names