| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium 3,6-dichloro-o-anisate or sodium 3,6-dichloro-2-methoxybenzoate |
| CAS: | sodium 3,6-dichloro-2-methoxybenzoate |
| Reg. No.: | 1982-69-0 |
| Formula: | C8H5Cl2NaO3 |
| Activity: | herbicides (benzoic acid herbicides) plant growth regulators (unclassified plant growth regulators) |
| Notes: | This substance is a derivative of dicamba [1918-00-9]. |
| Structure: | ![]() |
| Pronunciation: | dī-kǎm-ba sō-dē-am Guide to British pronunciation |
| InChIKey: | HLZCHRAMVPCKDU-UHFFFAOYSA-M |
| InChI: | InChI=1S/C8H6Cl2O3.Na/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;/h2-3H,1H3,(H,11,12);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names