| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 3,6-dichloro-o-anisic acid - 2-aminoethanol (1:1) or (2-hydroxyethyl)ammonium 3,6-dichloro-o-anisate or 3,6-dichloro-2-methoxybenzoic acid - 2-aminoethanol (1:1) or (2-hydroxyethyl)ammonium 3,6-dichloro-2-methoxybenzoate |
| CAS: | 3,6-dichloro-2-methoxybenzoic acid |
| Reg. No.: | 53404-28-7 |
| Formula: | C10H13Cl2NO4 |
| Activity: | herbicides (benzoic acid herbicides) plant growth regulators (unclassified plant growth regulators) |
| Notes: | This substance is a derivative of dicamba [1918-00-9]. The name “dianat-olamine” was used in the former USSR. |
| Structure: | ![]() |
| InChI: | InChI=1/C8H6Cl2O3.C2H7NO/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;3-1-2-4/h2-3H,1H3,(H,11,12);4H,1-3H2/f/h11H; |
A data sheet from the Compendium of Pesticide Common Names