| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | methyl 3,6-dichloro-o-anisate or methyl 3,6-dichloro-2-methoxybenzoate |
| CAS: | methyl 3,6-dichloro-2-methoxybenzoate |
| Reg. No.: | 6597-78-0 |
| Formula: | C9H8Cl2O3 |
| Activity: | herbicides (benzoic acid herbicides) plant growth regulators (unclassified plant growth regulators) |
| Notes: | This substance is a derivative of dicamba [1918-00-9]. The name “disugran” was formerly used in the USA. The names “dicamba” and “dicamba-methyl” were both formerly approved by ISO, but “dicamba-methyl” was deleted in 1989 as part of a rationalisation exercise. |
| Structure: |  |
| Pronunciation: | dī-kǎm-ba mē-thīl Guide to British pronunciation |
| InChIKey: | AWSBKDYHGOOSML-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H8Cl2O3/c1-13-8-6(11)4-3-5(10)7(8)9(12)14-2/h3-4H,1-2H3 |