| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 3,6-dichloro-o-anisic acid - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium 3,6-dichloro-o-anisate or 3,6-dichloro-2-methoxybenzoic acid - 2,2′-iminodiethanol (1:1) or bis(2-hydroxyethyl)ammonium 3,6-dichloro-2-methoxybenzoate |
| CAS: | 3,6-dichloro-2-methoxybenzoic acid compound with 2,2′-iminobis[ethanol] (1:1) |
| Reg. No.: | 25059-78-3 |
| Formula: | C12H17Cl2NO5 |
| Activity: | herbicides (benzoic acid herbicides) plant growth regulators (unclassified plant growth regulators) |
| Notes: | This substance is a derivative of dicamba [1918-00-9]. The name “dianat-diolamine” was used in the former USSR. |
| Structure: |  |
| InChI: | InChI=1/C8H6Cl2O3.C4H11NO2/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;6-3-1-5-2-4-7/h2-3H,1H3,(H,11,12);5-7H,1-4H2/f/h11H; |