Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 3,6-dichloro-2-methoxybenzoic acid—N-methylmethanamine (1/1) |
IUPAC name: | 3,6-dichloro-o-anisic acid - dimethylamine (1:1) or dimethylammonium 3,6-dichloro-o-anisate or 3,6-dichloro-2-methoxybenzoic acid - dimethylamine (1:1) or dimethylammonium 3,6-dichloro-2-methoxybenzoate |
CAS name: | 3,6-dichloro-2-methoxybenzoic acid compound with N-methylmethanamine (1:1) |
CAS Reg. No.: | 2300-66-5 |
Formula: | C10H13Cl2NO3 |
Activity: | herbicides (benzoic acid) |
Notes: | This substance is a derivative of dicamba [1918-00-9]. |
Structure: | |
Pronunciation: | dī-kǎm-ba dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
InChIKey: | JDRFUUBRGGDEIZ-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H6Cl2O3.C2H7N/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;1-3-2/h2-3H,1H3,(H,11,12);3H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names