| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 3,6-dichloro-o-anisic acid - 2-(2-aminoethoxy)ethanol (1:1) or [2-(2-hydroxyethoxy)ethyl]ammonium 3,6-dichloro-o-anisate or 3,6-dichloro-2-methoxybenzoic acid - 2-(2-aminoethoxy)ethanol (1:1) or [2-(2-hydroxyethoxy)ethyl]ammonium 3,6-dichloro-2-methoxybenzoate |
| CAS: | 3,6-dichloro-2-methoxybenzoic acid compound with 2-(2-aminoethoxy)ethanol (1:1) |
| Reg. No.: | 104040-79-1 |
| Formula: | C12H17Cl2NO5 |
| Activity: | herbicides (benzoic acid herbicides) plant growth regulators (unclassified plant growth regulators) |
| Notes: | This substance is a derivative of dicamba [1918-00-9]. The modifier “diglycolamine” has been invented by the manufacturer, and has not been submitted for approval by ISO. |
| Structure: |  |
| Pronunciation: | dī-kǎm-ba dī-glī-kǒl-a-mēn Guide to British pronunciation |
| InChIKey: | QURLONWWPWCPIC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H6Cl2O3.C4H11NO2/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;5-1-3-7-4-2-6/h2-3H,1H3,(H,11,12);6H,1-5H2 |