| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium 3,5-dimethyl-1,3,5-thiadiazinane-2-thiolate or sodium tetrahydro-3,5-dimethyl-1,3,5-thiadiazine-2-thiolate |
| CAS: | |
| Reg. No.: | 53404-60-7 |
| Formula: | C5H11N2NaS2 |
| Activity: | fungicides (cyclic dithiocarbamate fungicides) herbicides (dithiocarbamate herbicides) nematicides (unclassified nematicides) |
| Notes: | This substance is a derivative of dazomet [533-74-4]. The name “thiazone-sodium” was used in the former USSR. |
| Structure: |  |
| Pronunciation: | dǎz-ō-mět sō-dē-am Guide to British pronunciation |
| InChI: | InChI=1/C5H12N2S2.Na/c1-6-3-7(2)5(8)9-4-6;/h5,8H,3-4H2,1-2H3;/q;+1/p-1/fC5H11N2S2.Na/h8h;/q-1;m |