| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium 4-chloro-α-hydroxy-o-tolyloxyacetate |
| CAS: | sodium 2-[4-chloro-2-(hydroxymethyl)phenoxy]acetate |
| Reg. No.: | 32791-87-0 |
| Formula: | C9H8ClNaO4 |
| Activity: | plant growth regulators (unclassified plant growth regulators) |
| Notes: | This substance is a derivative of cloxyfonac [6386-63-6]. The name “座果酸” is approved in China for cloxyfonac and for cloxyfonac-sodium. |
| Structure: |  |
| Pronunciation: | klǒk-sē-fō-nǎk sō-dē-am Guide to British pronunciation |
| InChIKey: | KJBSWAMTBIEBMP-UHFFFAOYSA-M |
| InChI: | InChI=1S/C9H9ClO4.Na/c10-7-1-2-8(6(3-7)4-11)14-5-9(12)13;/h1-3,11H,4-5H2,(H,12,13);/q;+1/p-1 |