| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | 3,6-dichloropyridine-2-carboxylic acid - (2RS,2′RS,2″RS)-1,1′,1″-nitrilotripropan-2-ol (1:1) or (2RS,2′RS,2″RS)-tris(2-hydroxypropyl)ammonium 3,6-dichloropyridine-2-carboxylate or 3,6-dichloropicolinic acid - (2RS,2′RS,2″RS)-1,1′,1″-nitrilotripropan-2-ol (1:1) or (2RS,2′RS,2″RS)-tris(2-hydroxypropyl)ammonium 3,6-dichloropicolinate |
| CAS: | 3,6-dichloropyridine-2-carboxylic acid compound with 1,1′,1″-nitrilotris[2-propanol] (1:1) |
| Reg. No.: | |
| Formula: | C15H24Cl2N2O5 |
| Activity: | herbicides (picolinic acid herbicides; pyridine herbicides) |
| Notes: | This substance is a derivative of clopyralid [1702-17-6]. |
| Structure: | ![]() |
| Pronunciation: | klō-pīr-a-lǐd trǐs too hī-drǒk-sē-prō-pīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | JSJFUVBHOQIFNC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H21NO3.C6H3Cl2NO2/c1-7(11)4-10(5-8(2)12)6-9(3)13;7-3-1-2-4(8)9-5(3)6(10)11/h7-9,11-13H,4-6H2,1-3H3;1-2H,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names