| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | methyl (RS)-2-chloro-9-hydroxyfluorene-9-carboxylate |
| CAS: | methyl 2-chloro-9-hydroxy-9H-fluorene-9-carboxylate |
| Reg. No.: | 2536-31-4 |
| Formula: | C15H11ClO3 |
| Activity: | herbicides (unclassified herbicides) plant growth regulators (morphactins) |
| Notes: | This substance is a derivative of chlorflurenol [2464-37-1]. The name “chlorflurecol-methyl” is used in Canada and Denmark. |
| Structure: | ![]() |
| Pronunciation: | klor-flūr-ē-nǒl mē-thīl Guide to British pronunciation |
| InChI: | InChI=1/C15H11ClO3/c1-19-14(17)15(18)12-5-3-2-4-10(12)11-7-6-9(16)8-13(11)15/h2-8,18H,1H3/t15-/s3 |
A data sheet from the Compendium of Pesticide Common Names