Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | ammonium 3-amino-2,5-dichlorobenzoate |
IUPAC name: | ammonium 3-amino-2,5-dichlorobenzoate |
CAS name: | ammonium 3-amino-2,5-dichlorobenzoate |
CAS Reg. No.: | 1076-46-6 |
Formula: | C7H8Cl2N2O2 |
Activity: | herbicides (benzoic acid) |
Notes: | This substance is a derivative of chloramben [133-90-4]. |
Structure: | |
Pronunciation: | klor-ǎm-běn a-mōn-ē-am Guide to British pronunciation |
InChIKey: | RSSKZIYCSDAOJD-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H5Cl2NO2.H3N/c8-3-1-4(7(11)12)6(9)5(10)2-3;/h1-2H,10H2,(H,11,12);1H3 |
A data sheet from the Compendium of Pesticide Common Names