| Status: | modified ISO 1750 (provisionally approved) |
|---|---|
| IUPAC: | (E)-L-2-[2-(2-aminoethoxy)vinyl]glycine hydrochloride |
| CAS: | (2S,3E)-2-amino-4-(2-aminoethoxy)-3-butenoic acid monohydrochloride |
| Reg. No.: | 55720-26-8 |
| Formula: | C6H13ClN2O3 |
| Activity: | plant growth regulators (ethylene inhibitors) |
| Notes: | This substance is a derivative of aviglycine [49669-74-1]. The name “AVG hydrochloride” has been used in the literature but has no official status. |
| Structure: | ![]() |
| InChI: | InChI=1/C6H12N2O3.ClH/c7-2-4-11-3-1-5(8)6(9)10;/h1,3,5H,2,4,7-8H2,(H,9,10);1H/b3-1+;/t5-;/m0./s1/f/h9H; |
A data sheet from the Compendium of Pesticide Common Names