| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (2,4-dichlorophenoxy)acetic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium (2,4-dichlorophenoxy)acetate |
| CAS: | (2,4-dichlorophenoxy)acetic acid compound with 2,2′,2″-nitrilotris[ethanol] (1:1) |
| Reg. No.: | 2569-01-9 |
| Formula: | C14H21Cl2NO6 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | ![]() |
| Pronunciation: | too for dē trǒl-a-mēn Guide to British pronunciation |
| InChI: | InChI=1/C8H6Cl2O3.C6H15NO3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;8-4-1-7(2-5-9)3-6-10/h1-3H,4H2,(H,11,12);8-10H,1-6H2/f/h11H; |
A data sheet from the Compendium of Pesticide Common Names