| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (2,4-dichlorophenoxy)acetic acid - (2RS,2′RS,2″RS)-1,1′,1″-nitrilotripropan-2-ol (1:1) or (2RS,2′RS,2″RS)-tris(2-hydroxypropyl)ammonium (2,4-dichlorophenoxy)acetate |
| CAS: | 2-(2,4-dichlorophenoxy)acetic acid compound with 1,1′,1″-nitrilotris[2-propanol] (1:1) |
| Reg. No.: | 18584-79-7 (formerly 32341-80-3) |
| Formula: | C17H27Cl2NO6 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | ![]() |
| Pronunciation: | too for dē trǐs too hī-drǒk-sē-prō-pīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | SRPJGPPDQIFOGY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H21NO3.C8H6Cl2O3/c1-7(11)4-10(5-8(2)12)6-9(3)13;9-5-1-2-7(6(10)3-5)13-4-8(11)12/h7-9,11-13H,4-6H2,1-3H3;1-3H,4H2,(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names