| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (2,4-dichlorophenoxy)acetic acid - triethylamine (1:1) or triethylammonium (2,4-dichlorophenoxy)acetate |
| CAS: | 2-(2,4-dichlorophenoxy)acetic acid compound with N,N-diethylethanamine (1:1) |
| Reg. No.: | 2646-78-8 |
| Formula: | C14H21Cl2NO3 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | ![]() |
| Pronunciation: | too for dē trī-ē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | FEGJYGNUIXVOOQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H6Cl2O3.C6H15N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-4-7(5-2)6-3/h1-3H,4H2,(H,11,12);4-6H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names