| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | sodium (2,4-dichlorophenoxy)acetate |
| CAS: | sodium 2-(2,4-dichlorophenoxy)acetate |
| Reg. No.: | 2702-72-9 |
| Formula: | C8H5Cl2NaO3 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | ![]() |
| Pronunciation: | too for dē sō-dē-am Guide to British pronunciation |
| InChIKey: | RFOHRSIAXQACDB-UHFFFAOYSA-M |
| InChI: | InChI=1S/C8H6Cl2O3.Na/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;/h1-3H,4H2,(H,11,12);/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names