| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | methyl (2,4-dichlorophenoxy)acetate |
| CAS: | methyl 2-(2,4-dichlorophenoxy)acetate |
| Reg. No.: | 1928-38-7 |
| Formula: | C9H8Cl2O3 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | ![]() |
| Pronunciation: | too for dē mē-thīl Guide to British pronunciation |
| InChIKey: | HWIGZMADSFQMOI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H8Cl2O3/c1-13-9(12)5-14-8-3-2-6(10)4-7(8)11/h2-4H,5H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names