| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (2,4-dichlorophenoxy)acetic acid - heptylamine (1:1) or heptylammonium (2,4-dichlorophenoxy)acetate |
| CAS: | 2-(2,4-dichlorophenoxy)acetic acid compound with 1-heptanamine (1:1) |
| Reg. No.: | 37102-63-9 |
| Formula: | C15H23Cl2NO3 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | ![]() |
| Pronunciation: | too for dē hěp-tīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | UTILIQPPRUUSFN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H6Cl2O3.C7H17N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-2-3-4-5-6-7-8/h1-3H,4H2,(H,11,12);2-8H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names