Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | (2,4-dichlorophenoxy)acetic acid—N-ethylethanamine (1/1) |
IUPAC name: | (2,4-dichlorophenoxy)acetic acid - diethylamine (1:1) or diethylammonium (2,4-dichlorophenoxy)acetate |
CAS name: | 2-(2,4-dichlorophenoxy)acetic acid compound with N-ethylethanamine (1:1) |
CAS Reg. No.: | 20940-37-8 |
Formula: | C12H17Cl2NO3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
Structure: | |
Pronunciation: | too for dē dī-ē-thīl-a-mōn-ē-am Guide to British pronunciation |
InChIKey: | VQRSXYVRBBWVSQ-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H6Cl2O3.C4H11N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-3-5-4-2/h1-3H,4H2,(H,11,12);5H,3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names