Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-hydroxy-N,N,N-trimethylethan-1-aminium (2,4-dichlorophenoxy)acetate |
IUPAC name: | (2-hydroxyethyl)trimethylammonium (2,4-dichlorophenoxy)acetate |
CAS name: | 2-hydroxy-N,N,N-trimethylethanaminium (2,4-dichlorophenoxy)acetate (1:1) |
CAS Reg. No.: | 1048373-72-3 |
Formula: | C13H19Cl2NO4 |
Activity: | herbicides (phenoxyacetic) |
Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
Structure: | |
Pronunciation: | too for dē kō-lēn Guide to British pronunciation |
InChIKey: | OXJISOJFVQITNG-UHFFFAOYSA-M |
InChI: | InChI=1S/C8H6Cl2O3.C5H14NO/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-6(2,3)4-5-7/h1-3H,4H2,(H,11,12);7H,4-5H2,1-3H3/q;+1/p-1 |
A data sheet from the Compendium of Pesticide Common Names