| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | butyl (2,4-dichlorophenoxy)acetate |
| CAS: | butyl 2-(2,4-dichlorophenoxy)acetate |
| Reg. No.: | 94-80-4 |
| Formula: | C12H14Cl2O3 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | ![]() |
| Pronunciation: | too for dē bū-tīl Guide to British pronunciation |
| InChIKey: | UQMRAFJOBWOFNS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H14Cl2O3/c1-2-3-6-16-12(15)8-17-11-5-4-9(13)7-10(11)14/h4-5,7H,2-3,6,8H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names