| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-ethylhexyl (2,4-dichlorophenoxy)acetate |
| CAS: | 2-ethylhexyl 2-(2,4-dichlorophenoxy)acetate |
| Reg. No.: | 1928-43-4 |
| Formula: | C16H22Cl2O3 |
| Activity: | herbicides (phenoxyacetic herbicides) plant growth regulators (auxins) |
| Notes: | This substance is a derivative of 2,4-D [94-75-7]. |
| Structure: | ![]() |
| Pronunciation: | too for dē too ē-thīl-hěks-īl Guide to British pronunciation |
| InChIKey: | QZSFJRIWRPJUOH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H22Cl2O3/c1-3-5-6-12(4-2)10-21-16(19)11-20-15-8-7-13(17)9-14(15)18/h7-9,12H,3-6,10-11H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names